C25H25FN2O3 — CID 171940062
benzyl 3-[3-(cyanomethyl)-4-fluorobenzoyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171940062) has the molecular formula C25H25FN2O3 and a molecular weight of 420.48 g/mol. Its IUPAC name is benzyl 3-[3-(cyanomethyl)-4-fluorobenzoyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | benzyl 3-[3-(cyanomethyl)-4-fluorobenzoyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171940062 |
| Molecular Formula | C25H25FN2O3 |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | benzyl 3-[3-(cyanomethyl)-4-fluorobenzoyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | N#CCc1cc(C(=O)C2CC3CCCC(C2)N3C(=O)OCc2ccccc2)ccc1F |
| InChI | InChI=1S/C25H25FN2O3/c26-23-10-9-19(13-18(23)11-12-27)24(29)20-14-21-7-4-8-22(15-20)28(21)25(30)31-16-17-5-2-1-3-6-17/h1-3,5-6,9-10,13,20-22H,4,7-8,11,14-16H2 |
| InChIKey | OVFVLGAZSTTXIF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |