C21H22OS — CID 171943286
(4-phenylphenyl)-(9-thiabicyclo[3.3.1]nonan-3-yl)methanone (PubChem CID 171943286) has the molecular formula C21H22OS and a molecular weight of 322.47 g/mol. Its IUPAC name is (4-phenylphenyl)-(9-thiabicyclo[3.3.1]nonan-3-yl)methanone.
| Compound Name | (4-phenylphenyl)-(9-thiabicyclo[3.3.1]nonan-3-yl)methanone |
|---|---|
| PubChem CID | 171943286 |
| Molecular Formula | C21H22OS |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | (4-phenylphenyl)-(9-thiabicyclo[3.3.1]nonan-3-yl)methanone |
| SMILES | O=C(c1ccc(-c2ccccc2)cc1)C1CC2CCCC(C1)S2 |
| InChI | InChI=1S/C21H22OS/c22-21(18-13-19-7-4-8-20(14-18)23-19)17-11-9-16(10-12-17)15-5-2-1-3-6-15/h1-3,5-6,9-12,18-20H,4,7-8,13-14H2 |
| InChIKey | OBDWSKLSQXFWKE-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |