C13H12F2O4 — CID 2356812
[2-[4-(difluoromethoxy)phenyl]-2-oxoethyl] cyclopropanecarboxylate (PubChem CID 2356812) has the molecular formula C13H12F2O4 and a molecular weight of 270.23 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)phenyl]-2-oxoethyl] cyclopropanecarboxylate.
| Compound Name | [2-[4-(difluoromethoxy)phenyl]-2-oxoethyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 2356812 |
| Molecular Formula | C13H12F2O4 |
| Molecular Weight | 270.23 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | [2-[4-(difluoromethoxy)phenyl]-2-oxoethyl] cyclopropanecarboxylate |
| SMILES | O=C(COC(=O)C1CC1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C13H12F2O4/c14-13(15)19-10-5-3-8(4-6-10)11(16)7-18-12(17)9-1-2-9/h3-6,9,13H,1-2,7H2 |
| InChIKey | FSXVDODXBDWYEX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |