C15H18F2O2 — CID 114215551
(3,3-difluorocyclohexyl)-(4-ethoxyphenyl)methanone (PubChem CID 114215551) has the molecular formula C15H18F2O2 and a molecular weight of 268.30 g/mol. Its IUPAC name is (3,3-difluorocyclohexyl)-(4-ethoxyphenyl)methanone.
| Compound Name | (3,3-difluorocyclohexyl)-(4-ethoxyphenyl)methanone |
|---|---|
| PubChem CID | 114215551 |
| Molecular Formula | C15H18F2O2 |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | (3,3-difluorocyclohexyl)-(4-ethoxyphenyl)methanone |
| SMILES | CCOc1ccc(C(=O)C2CCCC(F)(F)C2)cc1 |
| InChI | InChI=1S/C15H18F2O2/c1-2-19-13-7-5-11(6-8-13)14(18)12-4-3-9-15(16,17)10-12/h5-8,12H,2-4,9-10H2,1H3 |
| InChIKey | WOIJCVIIQOHWJU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |