C10H11NO5S — CID 64911099
4-(1,1-dioxothiolane-3-carbonyl)-1H-pyrrole-2-carboxylic acid (PubChem CID 64911099) has the molecular formula C10H11NO5S and a molecular weight of 257.27 g/mol. Its IUPAC name is 4-(1,1-dioxothiolane-3-carbonyl)-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-(1,1-dioxothiolane-3-carbonyl)-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 64911099 |
| Molecular Formula | C10H11NO5S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 4-(1,1-dioxothiolane-3-carbonyl)-1H-pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)C2CCS(=O)(=O)C2)c[nH]1 |
| InChI | InChI=1S/C10H11NO5S/c12-9(6-1-2-17(15,16)5-6)7-3-8(10(13)14)11-4-7/h3-4,6,11H,1-2,5H2,(H,13,14) |
| InChIKey | PDKCPIIJIVHIPP-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |