C17H21Cl2N3O3 — CID 108537890
N-[2-[(3,4-dichlorobenzoyl)amino]ethyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide (PubChem CID 108537890) has the molecular formula C17H21Cl2N3O3 and a molecular weight of 386.28 g/mol. Its IUPAC name is N-[2-[(3,4-dichlorobenzoyl)amino]ethyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide.
| Compound Name | N-[2-[(3,4-dichlorobenzoyl)amino]ethyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 108537890 |
| Molecular Formula | C17H21Cl2N3O3 |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | N-[2-[(3,4-dichlorobenzoyl)amino]ethyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide |
| SMILES | CC(C)N1CC(C(=O)NCCNC(=O)c2ccc(Cl)c(Cl)c2)CC1=O |
| InChI | InChI=1S/C17H21Cl2N3O3/c1-10(2)22-9-12(8-15(22)23)17(25)21-6-5-20-16(24)11-3-4-13(18)14(19)7-11/h3-4,7,10,12H,5-6,8-9H2,1-2H3,(H,20,24)(H,21,25) |
| InChIKey | ZXYNEAJPUKLPDS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|