C16H20Cl2N2O4S — CID 78883378
3,4-dichloro-N-[2-[(2-cyclopentylsulfonylacetyl)amino]ethyl]benzamide (PubChem CID 78883378) has the molecular formula C16H20Cl2N2O4S and a molecular weight of 407.32 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[(2-cyclopentylsulfonylacetyl)amino]ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-[(2-cyclopentylsulfonylacetyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 78883378 |
| Molecular Formula | C16H20Cl2N2O4S |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 3,4-dichloro-N-[2-[(2-cyclopentylsulfonylacetyl)amino]ethyl]benzamide |
| SMILES | O=C(CS(=O)(=O)C1CCCC1)NCCNC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H20Cl2N2O4S/c17-13-6-5-11(9-14(13)18)16(22)20-8-7-19-15(21)10-25(23,24)12-3-1-2-4-12/h5-6,9,12H,1-4,7-8,10H2,(H,19,21)(H,20,22) |
| InChIKey | ZNSVAYAMEOOMHA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|