C18H24Cl2N2O2 — CID 113056706
N-[2-[acetyl(cycloheptyl)amino]ethyl]-3,4-dichlorobenzamide (PubChem CID 113056706) has the molecular formula C18H24Cl2N2O2 and a molecular weight of 371.31 g/mol. Its IUPAC name is N-[2-[acetyl(cycloheptyl)amino]ethyl]-3,4-dichlorobenzamide.
| Compound Name | N-[2-[acetyl(cycloheptyl)amino]ethyl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 113056706 |
| Molecular Formula | C18H24Cl2N2O2 |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | N-[2-[acetyl(cycloheptyl)amino]ethyl]-3,4-dichlorobenzamide |
| SMILES | CC(=O)N(CCNC(=O)c1ccc(Cl)c(Cl)c1)C1CCCCCC1 |
| InChI | InChI=1S/C18H24Cl2N2O2/c1-13(23)22(15-6-4-2-3-5-7-15)11-10-21-18(24)14-8-9-16(19)17(20)12-14/h8-9,12,15H,2-7,10-11H2,1H3,(H,21,24) |
| InChIKey | HONVWMQJDXTMBC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |