C18H25ClN2O2S3 — CID 165392480
1-[2-(4-chlorophenyl)sulfanylacetyl]-N-[2-(ethyldisulfanyl)ethyl]piperidine-4-carboxamide (PubChem CID 165392480) has the molecular formula C18H25ClN2O2S3 and a molecular weight of 433.06 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfanylacetyl]-N-[2-(ethyldisulfanyl)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(4-chlorophenyl)sulfanylacetyl]-N-[2-(ethyldisulfanyl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 165392480 |
| Molecular Formula | C18H25ClN2O2S3 |
| Molecular Weight | 433.06 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfanylacetyl]-N-[2-(ethyldisulfanyl)ethyl]piperidine-4-carboxamide |
| SMILES | CCSSCCNC(=O)C1CCN(C(=O)CSc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H25ClN2O2S3/c1-2-25-26-12-9-20-18(23)14-7-10-21(11-8-14)17(22)13-24-16-5-3-15(19)4-6-16/h3-6,14H,2,7-13H2,1H3,(H,20,23) |
| InChIKey | AXYCJEPSPKYNPR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.06 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|