C20H29ClN4O2S — CID 45281605
N-[2-(4-chlorophenyl)sulfanylethyl]-2-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]acetamide (PubChem CID 45281605) has the molecular formula C20H29ClN4O2S and a molecular weight of 425.00 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylethyl]-2-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]acetamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylethyl]-2-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 45281605 |
| Molecular Formula | C20H29ClN4O2S |
| Molecular Weight | 425.00 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylethyl]-2-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(CC(=O)N2CCCC2)CC1)NCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H29ClN4O2S/c21-17-3-5-18(6-4-17)28-14-7-22-19(26)15-23-10-12-24(13-11-23)16-20(27)25-8-1-2-9-25/h3-6H,1-2,7-16H2,(H,22,26) |
| InChIKey | UBGZYNMSKKXZTE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.00 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|