C18H23F3N2O2 — CID 113005611
N-pentyl-1-(2,3,4-trifluorobenzoyl)piperidine-4-carboxamide (PubChem CID 113005611) has the molecular formula C18H23F3N2O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is N-pentyl-1-(2,3,4-trifluorobenzoyl)piperidine-4-carboxamide.
| Compound Name | N-pentyl-1-(2,3,4-trifluorobenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 113005611 |
| Molecular Formula | C18H23F3N2O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | N-pentyl-1-(2,3,4-trifluorobenzoyl)piperidine-4-carboxamide |
| SMILES | CCCCCNC(=O)C1CCN(C(=O)c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C18H23F3N2O2/c1-2-3-4-9-22-17(24)12-7-10-23(11-8-12)18(25)13-5-6-14(19)16(21)15(13)20/h5-6,12H,2-4,7-11H2,1H3,(H,22,24) |
| InChIKey | GAIJOCKXQZDVQF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|