C21H31N3O3 — CID 109149868
4-N-(3-acetamidophenyl)-1-N-pentylcyclohexane-1,4-dicarboxamide (PubChem CID 109149868) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is 4-N-(3-acetamidophenyl)-1-N-pentylcyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-(3-acetamidophenyl)-1-N-pentylcyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109149868 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 4-N-(3-acetamidophenyl)-1-N-pentylcyclohexane-1,4-dicarboxamide |
| SMILES | CCCCCNC(=O)C1CCC(C(=O)Nc2cccc(NC(C)=O)c2)CC1 |
| InChI | InChI=1S/C21H31N3O3/c1-3-4-5-13-22-20(26)16-9-11-17(12-10-16)21(27)24-19-8-6-7-18(14-19)23-15(2)25/h6-8,14,16-17H,3-5,9-13H2,1-2H3,(H,22,26)(H,23,25)(H,24,27) |
| InChIKey | KCDVYNJWHVTKPO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|