C21H30N2O4 — CID 109149881
4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-N-pentylcyclohexane-1,4-dicarboxamide (PubChem CID 109149881) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is 4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-N-pentylcyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-N-pentylcyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109149881 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-N-pentylcyclohexane-1,4-dicarboxamide |
| SMILES | CCCCCNC(=O)C1CCC(C(=O)Nc2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C21H30N2O4/c1-2-3-4-11-22-20(24)15-5-7-16(8-6-15)21(25)23-17-9-10-18-19(14-17)27-13-12-26-18/h9-10,14-16H,2-8,11-13H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | ZMOBNBWESOZQSQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|