C18H23N5O5 — CID 15735525
(2S)-1-[(2S)-1-(2-aminoacetyl)pyrrolidine-2-carbonyl]-N-(4-nitrophenyl)pyrrolidine-2-carboxamide (PubChem CID 15735525) has the molecular formula C18H23N5O5 and a molecular weight of 389.41 g/mol. Its IUPAC name is (2S)-1-[(2S)-1-(2-aminoacetyl)pyrrolidine-2-carbonyl]-N-(4-nitrophenyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-1-(2-aminoacetyl)pyrrolidine-2-carbonyl]-N-(4-nitrophenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 15735525 |
| Molecular Formula | C18H23N5O5 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | (2S)-1-[(2S)-1-(2-aminoacetyl)pyrrolidine-2-carbonyl]-N-(4-nitrophenyl)pyrrolidine-2-carboxamide |
| SMILES | NCC(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H23N5O5/c19-11-16(24)21-9-2-4-15(21)18(26)22-10-1-3-14(22)17(25)20-12-5-7-13(8-6-12)23(27)28/h5-8,14-15H,1-4,9-11,19H2,(H,20,25)/t14-,15-/m0/s1 |
| InChIKey | UUWFBAFUDUAMEM-GJZGRUSLSA-N |
| XLogP | 0.47 |
| TPSA | 138.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|