C25H31N5O8S — CID 175130723
(2S)-1-[(2S)-1-(2-aminoacetyl)pyrrolidine-2-carbonyl]-N-(4-nitrophenyl)pyrrolidine-2-carboxamide;4-methylbenzenesulfonic acid (PubChem CID 175130723) has the molecular formula C25H31N5O8S and a molecular weight of 561.62 g/mol. Its IUPAC name is (2S)-1-[(2S)-1-(2-aminoacetyl)pyrrolidine-2-carbonyl]-N-(4-nitrophenyl)pyrrolidine-2-carboxamide;4-methylbenzenesulfonic acid.
| Compound Name | (2S)-1-[(2S)-1-(2-aminoacetyl)pyrrolidine-2-carbonyl]-N-(4-nitrophenyl)pyrrolidine-2-carboxamide;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 175130723 |
| Molecular Formula | C25H31N5O8S |
| Molecular Weight | 561.62 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | (2S)-1-[(2S)-1-(2-aminoacetyl)pyrrolidine-2-carbonyl]-N-(4-nitrophenyl)pyrrolidine-2-carboxamide;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.NCC(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H23N5O5.C7H8O3S/c19-11-16(24)21-9-2-4-15(21)18(26)22-10-1-3-14(22)17(25)20-12-5-7-13(8-6-12)23(27)28;1-6-2-4-7(5-3-6)11(8,9)10/h5-8,14-15H,1-4,9-11,19H2,(H,20,25);2-5H,1H3,(H,8,9,10)/t14-,15-;/m0./s1 |
| InChIKey | HOERPJVOAQFOFX-YYLIZZNMSA-N |
| XLogP | 1.72 |
| TPSA | 193.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.62 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|