C15H18N4O6 — CID 133126658
(3S)-3-amino-4-[(2R)-2-[(4-nitrophenyl)carbamoyl]pyrrolidin-1-yl]-4-oxobutanoic acid (PubChem CID 133126658) has the molecular formula C15H18N4O6 and a molecular weight of 350.33 g/mol. Its IUPAC name is (3S)-3-amino-4-[(2R)-2-[(4-nitrophenyl)carbamoyl]pyrrolidin-1-yl]-4-oxobutanoic acid.
| Compound Name | (3S)-3-amino-4-[(2R)-2-[(4-nitrophenyl)carbamoyl]pyrrolidin-1-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 133126658 |
| Molecular Formula | C15H18N4O6 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | (3S)-3-amino-4-[(2R)-2-[(4-nitrophenyl)carbamoyl]pyrrolidin-1-yl]-4-oxobutanoic acid |
| SMILES | N[C@@H](CC(=O)O)C(=O)N1CCC[C@@H]1C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H18N4O6/c16-11(8-13(20)21)15(23)18-7-1-2-12(18)14(22)17-9-3-5-10(6-4-9)19(24)25/h3-6,11-12H,1-2,7-8,16H2,(H,17,22)(H,20,21)/t11-,12+/m0/s1 |
| InChIKey | XOJCPCPXSLLQGF-NWDGAFQWSA-N |
| XLogP | 0.33 |
| TPSA | 155.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|