C19H27N5O5S — CID 69465411
(2S)-1-[(2S)-2-aminopropanoyl]-N-[(2S)-4-methylsulfanyl-1-(4-nitroanilino)-1-oxobutan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 69465411) has the molecular formula C19H27N5O5S and a molecular weight of 437.52 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-aminopropanoyl]-N-[(2S)-4-methylsulfanyl-1-(4-nitroanilino)-1-oxobutan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-aminopropanoyl]-N-[(2S)-4-methylsulfanyl-1-(4-nitroanilino)-1-oxobutan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 69465411 |
| Molecular Formula | C19H27N5O5S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | (2S)-1-[(2S)-2-aminopropanoyl]-N-[(2S)-4-methylsulfanyl-1-(4-nitroanilino)-1-oxobutan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | CSCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@H](C)N)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H27N5O5S/c1-12(20)19(27)23-10-3-4-16(23)18(26)22-15(9-11-30-2)17(25)21-13-5-7-14(8-6-13)24(28)29/h5-8,12,15-16H,3-4,9-11,20H2,1-2H3,(H,21,25)(H,22,26)/t12-,15-,16-/m0/s1 |
| InChIKey | SHOLHCMQNSZKNS-RCBQFDQVSA-N |
| XLogP | 1.11 |
| TPSA | 147.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|