C21H28N4O5 — CID 46451174
methyl 7-[[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]amino]heptanoate (PubChem CID 46451174) has the molecular formula C21H28N4O5 and a molecular weight of 416.48 g/mol. Its IUPAC name is methyl 7-[[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]amino]heptanoate.
| Compound Name | methyl 7-[[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]amino]heptanoate |
|---|---|
| PubChem CID | 46451174 |
| Molecular Formula | C21H28N4O5 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | methyl 7-[[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]amino]heptanoate |
| SMILES | COC(=O)CCCCCCNC(=O)c1ccc(Cn2nc(C)c([N+](=O)[O-])c2C)cc1 |
| InChI | InChI=1S/C21H28N4O5/c1-15-20(25(28)29)16(2)24(23-15)14-17-9-11-18(12-10-17)21(27)22-13-7-5-4-6-8-19(26)30-3/h9-12H,4-8,13-14H2,1-3H3,(H,22,27) |
| InChIKey | HXZVABIOAMZULI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|