C25H30N4O3 — CID 4748327
N-[1-(4-tert-butylphenyl)ethyl]-3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzamide (PubChem CID 4748327) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-[1-(4-tert-butylphenyl)ethyl]-3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzamide.
| Compound Name | N-[1-(4-tert-butylphenyl)ethyl]-3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 4748327 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | N-[1-(4-tert-butylphenyl)ethyl]-3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzamide |
| SMILES | Cc1nn(Cc2cccc(C(=O)NC(C)c3ccc(C(C)(C)C)cc3)c2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C25H30N4O3/c1-16(20-10-12-22(13-11-20)25(4,5)6)26-24(30)21-9-7-8-19(14-21)15-28-18(3)23(29(31)32)17(2)27-28/h7-14,16H,15H2,1-6H3,(H,26,30) |
| InChIKey | GEXQHANSLSIWMD-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|