C20H19N3O5 — CID 19406103
1-methyl-4-[[5-[(2-prop-2-enylphenoxy)methyl]furan-2-carbonyl]amino]pyrazole-5-carboxylic acid (PubChem CID 19406103) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is 1-methyl-4-[[5-[(2-prop-2-enylphenoxy)methyl]furan-2-carbonyl]amino]pyrazole-5-carboxylic acid.
| Compound Name | 1-methyl-4-[[5-[(2-prop-2-enylphenoxy)methyl]furan-2-carbonyl]amino]pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 19406103 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 1-methyl-4-[[5-[(2-prop-2-enylphenoxy)methyl]furan-2-carbonyl]amino]pyrazole-5-carboxylic acid |
| SMILES | C=CCc1ccccc1OCc1ccc(C(=O)Nc2cnn(C)c2C(=O)O)o1 |
| InChI | InChI=1S/C20H19N3O5/c1-3-6-13-7-4-5-8-16(13)27-12-14-9-10-17(28-14)19(24)22-15-11-21-23(2)18(15)20(25)26/h3-5,7-11H,1,6,12H2,2H3,(H,22,24)(H,25,26) |
| InChIKey | DYMGYGKLQVGFCO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 106.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|