C25H23N3O3 — CID 19286216
N-(1-benzylpyrazol-3-yl)-5-[(2-prop-2-enylphenoxy)methyl]furan-2-carboxamide (PubChem CID 19286216) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is N-(1-benzylpyrazol-3-yl)-5-[(2-prop-2-enylphenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(1-benzylpyrazol-3-yl)-5-[(2-prop-2-enylphenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19286216 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | N-(1-benzylpyrazol-3-yl)-5-[(2-prop-2-enylphenoxy)methyl]furan-2-carboxamide |
| SMILES | C=CCc1ccccc1OCc1ccc(C(=O)Nc2ccn(Cc3ccccc3)n2)o1 |
| InChI | InChI=1S/C25H23N3O3/c1-2-8-20-11-6-7-12-22(20)30-18-21-13-14-23(31-21)25(29)26-24-15-16-28(27-24)17-19-9-4-3-5-10-19/h2-7,9-16H,1,8,17-18H2,(H,26,27,29) |
| InChIKey | MLBNAZPTVVLXQY-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|