C25H20Cl3N3O3 — CID 19405273
N-[4-chloro-1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]-5-[(2-prop-2-enylphenoxy)methyl]furan-2-carboxamide (PubChem CID 19405273) has the molecular formula C25H20Cl3N3O3 and a molecular weight of 516.81 g/mol. Its IUPAC name is N-[4-chloro-1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]-5-[(2-prop-2-enylphenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[4-chloro-1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]-5-[(2-prop-2-enylphenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19405273 |
| Molecular Formula | C25H20Cl3N3O3 |
| Molecular Weight | 516.81 g/mol |
| Exact Mass | 515.06 |
| IUPAC Name | N-[4-chloro-1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]-5-[(2-prop-2-enylphenoxy)methyl]furan-2-carboxamide |
| SMILES | C=CCc1ccccc1OCc1ccc(C(=O)Nc2nn(Cc3c(Cl)cccc3Cl)cc2Cl)o1 |
| InChI | InChI=1S/C25H20Cl3N3O3/c1-2-6-16-7-3-4-10-22(16)33-15-17-11-12-23(34-17)25(32)29-24-21(28)14-31(30-24)13-18-19(26)8-5-9-20(18)27/h2-5,7-12,14H,1,6,13,15H2,(H,29,30,32) |
| InChIKey | AXABBGGIBHQXII-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.81 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|