C24H25NO3 — CID 19448810
N-(1-phenylpropyl)-5-[(2-prop-2-enylphenoxy)methyl]furan-2-carboxamide (PubChem CID 19448810) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is N-(1-phenylpropyl)-5-[(2-prop-2-enylphenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(1-phenylpropyl)-5-[(2-prop-2-enylphenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19448810 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | N-(1-phenylpropyl)-5-[(2-prop-2-enylphenoxy)methyl]furan-2-carboxamide |
| SMILES | C=CCc1ccccc1OCc1ccc(C(=O)NC(CC)c2ccccc2)o1 |
| InChI | InChI=1S/C24H25NO3/c1-3-10-19-13-8-9-14-22(19)27-17-20-15-16-23(28-20)24(26)25-21(4-2)18-11-6-5-7-12-18/h3,5-9,11-16,21H,1,4,10,17H2,2H3,(H,25,26) |
| InChIKey | PDSHMOVFLGIANE-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|