C21H15BrN2O3 — CID 35325335
5-[(2-bromophenoxy)methyl]-N-quinolin-8-ylfuran-2-carboxamide (PubChem CID 35325335) has the molecular formula C21H15BrN2O3 and a molecular weight of 423.27 g/mol. Its IUPAC name is 5-[(2-bromophenoxy)methyl]-N-quinolin-8-ylfuran-2-carboxamide.
| Compound Name | 5-[(2-bromophenoxy)methyl]-N-quinolin-8-ylfuran-2-carboxamide |
|---|---|
| PubChem CID | 35325335 |
| Molecular Formula | C21H15BrN2O3 |
| Molecular Weight | 423.27 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | 5-[(2-bromophenoxy)methyl]-N-quinolin-8-ylfuran-2-carboxamide |
| SMILES | O=C(Nc1cccc2cccnc12)c1ccc(COc2ccccc2Br)o1 |
| InChI | InChI=1S/C21H15BrN2O3/c22-16-7-1-2-9-18(16)26-13-15-10-11-19(27-15)21(25)24-17-8-3-5-14-6-4-12-23-20(14)17/h1-12H,13H2,(H,24,25) |
| InChIKey | DMXZJZPZQFNFDU-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.27 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |