C23H15Cl5N4O4 — CID 19465960
1-methyl-N-[3-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbonyl]amino]phenyl]pyrazole-3-carboxamide (PubChem CID 19465960) has the molecular formula C23H15Cl5N4O4 and a molecular weight of 588.66 g/mol. Its IUPAC name is 1-methyl-N-[3-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbonyl]amino]phenyl]pyrazole-3-carboxamide.
| Compound Name | 1-methyl-N-[3-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbonyl]amino]phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19465960 |
| Molecular Formula | C23H15Cl5N4O4 |
| Molecular Weight | 588.66 g/mol |
| Exact Mass | 585.95 |
| IUPAC Name | 1-methyl-N-[3-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbonyl]amino]phenyl]pyrazole-3-carboxamide |
| SMILES | Cn1ccc(C(=O)Nc2cccc(NC(=O)c3ccc(COc4c(Cl)c(Cl)c(Cl)c(Cl)c4Cl)o3)c2)n1 |
| InChI | InChI=1S/C23H15Cl5N4O4/c1-32-8-7-14(31-32)22(33)29-11-3-2-4-12(9-11)30-23(34)15-6-5-13(36-15)10-35-21-19(27)17(25)16(24)18(26)20(21)28/h2-9H,10H2,1H3,(H,29,33)(H,30,34) |
| InChIKey | WDROAKPPEQPBCH-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.66 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|