C26H30O4 — CID 19571230
(E)-1-(1-adamantyl)-3-[5-[(4-ethoxyphenoxy)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19571230) has the molecular formula C26H30O4 and a molecular weight of 406.52 g/mol. Its IUPAC name is (E)-1-(1-adamantyl)-3-[5-[(4-ethoxyphenoxy)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(1-adamantyl)-3-[5-[(4-ethoxyphenoxy)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19571230 |
| Molecular Formula | C26H30O4 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | (E)-1-(1-adamantyl)-3-[5-[(4-ethoxyphenoxy)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | CCOc1ccc(OCc2ccc(/C=C/C(=O)C34CC5CC(CC(C5)C3)C4)o2)cc1 |
| InChI | InChI=1S/C26H30O4/c1-2-28-21-3-5-22(6-4-21)29-17-24-8-7-23(30-24)9-10-25(27)26-14-18-11-19(15-26)13-20(12-18)16-26/h3-10,18-20H,2,11-17H2,1H3/b10-9+ |
| InChIKey | UKIJPZFMGNBJDJ-MDZDMXLPSA-N |
| XLogP | 6.06 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|