C27H35NO3 — CID 19446640
N-[1-(1-adamantyl)propyl]-5-[(4-ethylphenoxy)methyl]furan-2-carboxamide (PubChem CID 19446640) has the molecular formula C27H35NO3 and a molecular weight of 421.58 g/mol. Its IUPAC name is N-[1-(1-adamantyl)propyl]-5-[(4-ethylphenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[1-(1-adamantyl)propyl]-5-[(4-ethylphenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19446640 |
| Molecular Formula | C27H35NO3 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | N-[1-(1-adamantyl)propyl]-5-[(4-ethylphenoxy)methyl]furan-2-carboxamide |
| SMILES | CCc1ccc(OCc2ccc(C(=O)NC(CC)C34CC5CC(CC(C5)C3)C4)o2)cc1 |
| InChI | InChI=1S/C27H35NO3/c1-3-18-5-7-22(8-6-18)30-17-23-9-10-24(31-23)26(29)28-25(4-2)27-14-19-11-20(15-27)13-21(12-19)16-27/h5-10,19-21,25H,3-4,11-17H2,1-2H3,(H,28,29) |
| InChIKey | WLZLYZZLFAJZFG-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |