C25H29ClFNO3 — CID 19452955
N-[1-(1-adamantyl)propyl]-5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19452955) has the molecular formula C25H29ClFNO3 and a molecular weight of 445.96 g/mol. Its IUPAC name is N-[1-(1-adamantyl)propyl]-5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[1-(1-adamantyl)propyl]-5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19452955 |
| Molecular Formula | C25H29ClFNO3 |
| Molecular Weight | 445.96 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | N-[1-(1-adamantyl)propyl]-5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-carboxamide |
| SMILES | CCC(NC(=O)c1ccc(COc2ccc(F)cc2Cl)o1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H29ClFNO3/c1-2-23(25-11-15-7-16(12-25)9-17(8-15)13-25)28-24(29)22-6-4-19(31-22)14-30-21-5-3-18(27)10-20(21)26/h3-6,10,15-17,23H,2,7-9,11-14H2,1H3,(H,28,29) |
| InChIKey | NKDLHPIMXWHLKG-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.96 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |