C27H35NO4 — CID 19413323
N-[1-(1-adamantyl)propyl]-5-[(4-ethoxyphenoxy)methyl]furan-2-carboxamide (PubChem CID 19413323) has the molecular formula C27H35NO4 and a molecular weight of 437.58 g/mol. Its IUPAC name is N-[1-(1-adamantyl)propyl]-5-[(4-ethoxyphenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[1-(1-adamantyl)propyl]-5-[(4-ethoxyphenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19413323 |
| Molecular Formula | C27H35NO4 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | N-[1-(1-adamantyl)propyl]-5-[(4-ethoxyphenoxy)methyl]furan-2-carboxamide |
| SMILES | CCOc1ccc(OCc2ccc(C(=O)NC(CC)C34CC5CC(CC(C5)C3)C4)o2)cc1 |
| InChI | InChI=1S/C27H35NO4/c1-3-25(27-14-18-11-19(15-27)13-20(12-18)16-27)28-26(29)24-10-9-23(32-24)17-31-22-7-5-21(6-8-22)30-4-2/h5-10,18-20,25H,3-4,11-17H2,1-2H3,(H,28,29) |
| InChIKey | IEPGKQNYCOCAEG-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |