C25H29ClN2O5 — CID 19459528
N-[1-(1-adamantyl)propyl]-5-[(2-chloro-5-nitrophenoxy)methyl]furan-2-carboxamide (PubChem CID 19459528) has the molecular formula C25H29ClN2O5 and a molecular weight of 472.97 g/mol. Its IUPAC name is N-[1-(1-adamantyl)propyl]-5-[(2-chloro-5-nitrophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[1-(1-adamantyl)propyl]-5-[(2-chloro-5-nitrophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19459528 |
| Molecular Formula | C25H29ClN2O5 |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | N-[1-(1-adamantyl)propyl]-5-[(2-chloro-5-nitrophenoxy)methyl]furan-2-carboxamide |
| SMILES | CCC(NC(=O)c1ccc(COc2cc([N+](=O)[O-])ccc2Cl)o1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H29ClN2O5/c1-2-23(25-11-15-7-16(12-25)9-17(8-15)13-25)27-24(29)21-6-4-19(33-21)14-32-22-10-18(28(30)31)3-5-20(22)26/h3-6,10,15-17,23H,2,7-9,11-14H2,1H3,(H,27,29) |
| InChIKey | BREICTYZLUCWER-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 94.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|