C25H27ClN2O5 — CID 19461862
N-[1-(4-butan-2-ylphenyl)propyl]-5-[(2-chloro-4-nitrophenoxy)methyl]furan-2-carboxamide (PubChem CID 19461862) has the molecular formula C25H27ClN2O5 and a molecular weight of 470.95 g/mol. Its IUPAC name is N-[1-(4-butan-2-ylphenyl)propyl]-5-[(2-chloro-4-nitrophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[1-(4-butan-2-ylphenyl)propyl]-5-[(2-chloro-4-nitrophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19461862 |
| Molecular Formula | C25H27ClN2O5 |
| Molecular Weight | 470.95 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | N-[1-(4-butan-2-ylphenyl)propyl]-5-[(2-chloro-4-nitrophenoxy)methyl]furan-2-carboxamide |
| SMILES | CCC(C)c1ccc(C(CC)NC(=O)c2ccc(COc3ccc([N+](=O)[O-])cc3Cl)o2)cc1 |
| InChI | InChI=1S/C25H27ClN2O5/c1-4-16(3)17-6-8-18(9-7-17)22(5-2)27-25(29)24-13-11-20(33-24)15-32-23-12-10-19(28(30)31)14-21(23)26/h6-14,16,22H,4-5,15H2,1-3H3,(H,27,29) |
| InChIKey | WJGQCCIWZUBPNP-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 94.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.95 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|