C28H35NO3 — CID 19448118
N-[1-(4-butan-2-ylphenyl)propyl]-5-[(4-propan-2-ylphenoxy)methyl]furan-2-carboxamide (PubChem CID 19448118) has the molecular formula C28H35NO3 and a molecular weight of 433.59 g/mol. Its IUPAC name is N-[1-(4-butan-2-ylphenyl)propyl]-5-[(4-propan-2-ylphenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[1-(4-butan-2-ylphenyl)propyl]-5-[(4-propan-2-ylphenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19448118 |
| Molecular Formula | C28H35NO3 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | N-[1-(4-butan-2-ylphenyl)propyl]-5-[(4-propan-2-ylphenoxy)methyl]furan-2-carboxamide |
| SMILES | CCC(C)c1ccc(C(CC)NC(=O)c2ccc(COc3ccc(C(C)C)cc3)o2)cc1 |
| InChI | InChI=1S/C28H35NO3/c1-6-20(5)22-8-10-23(11-9-22)26(7-2)29-28(30)27-17-16-25(32-27)18-31-24-14-12-21(13-15-24)19(3)4/h8-17,19-20,26H,6-7,18H2,1-5H3,(H,29,30) |
| InChIKey | BDCTVSWWHIPDIK-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |