C29H39NO3 — CID 19450525
N-[1-(1-adamantyl)propyl]-5-[(4-butan-2-ylphenoxy)methyl]furan-2-carboxamide (PubChem CID 19450525) has the molecular formula C29H39NO3 and a molecular weight of 449.64 g/mol. Its IUPAC name is N-[1-(1-adamantyl)propyl]-5-[(4-butan-2-ylphenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[1-(1-adamantyl)propyl]-5-[(4-butan-2-ylphenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19450525 |
| Molecular Formula | C29H39NO3 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.29 |
| IUPAC Name | N-[1-(1-adamantyl)propyl]-5-[(4-butan-2-ylphenoxy)methyl]furan-2-carboxamide |
| SMILES | CCC(C)c1ccc(OCc2ccc(C(=O)NC(CC)C34CC5CC(CC(C5)C3)C4)o2)cc1 |
| InChI | InChI=1S/C29H39NO3/c1-4-19(3)23-6-8-24(9-7-23)32-18-25-10-11-26(33-25)28(31)30-27(5-2)29-15-20-12-21(16-29)14-22(13-20)17-29/h6-11,19-22,27H,4-5,12-18H2,1-3H3,(H,30,31) |
| InChIKey | JOELXKSJYKKGTD-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |