C20H16BrF3N2O3 — CID 19569295
(E)-1-(4-bromo-1-ethylpyrazol-5-yl)-3-[5-[[3-(trifluoromethyl)phenoxy]methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19569295) has the molecular formula C20H16BrF3N2O3 and a molecular weight of 469.26 g/mol. Its IUPAC name is (E)-1-(4-bromo-1-ethylpyrazol-5-yl)-3-[5-[[3-(trifluoromethyl)phenoxy]methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-bromo-1-ethylpyrazol-5-yl)-3-[5-[[3-(trifluoromethyl)phenoxy]methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19569295 |
| Molecular Formula | C20H16BrF3N2O3 |
| Molecular Weight | 469.26 g/mol |
| Exact Mass | 468.03 |
| IUPAC Name | (E)-1-(4-bromo-1-ethylpyrazol-5-yl)-3-[5-[[3-(trifluoromethyl)phenoxy]methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | CCn1ncc(Br)c1C(=O)/C=C/c1ccc(COc2cccc(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C20H16BrF3N2O3/c1-2-26-19(17(21)11-25-26)18(27)9-8-14-6-7-16(29-14)12-28-15-5-3-4-13(10-15)20(22,23)24/h3-11H,2,12H2,1H3/b9-8+ |
| InChIKey | CJOPGUACXWQGJX-CMDGGOBGSA-N |
| XLogP | 5.75 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.26 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|