C22H21ClN4O3S — CID 19289832
(5E)-5-[[5-[(2-chloro-6-methylphenoxy)methyl]furan-2-yl]methylidene]-3-[(1-ethylpyrazol-4-yl)methyl]-2-sulfanylideneimidazolidin-4-one (PubChem CID 19289832) has the molecular formula C22H21ClN4O3S and a molecular weight of 456.96 g/mol. Its IUPAC name is (5E)-5-[[5-[(2-chloro-6-methylphenoxy)methyl]furan-2-yl]methylidene]-3-[(1-ethylpyrazol-4-yl)methyl]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[5-[(2-chloro-6-methylphenoxy)methyl]furan-2-yl]methylidene]-3-[(1-ethylpyrazol-4-yl)methyl]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19289832 |
| Molecular Formula | C22H21ClN4O3S |
| Molecular Weight | 456.96 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | (5E)-5-[[5-[(2-chloro-6-methylphenoxy)methyl]furan-2-yl]methylidene]-3-[(1-ethylpyrazol-4-yl)methyl]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCn1cc(CN2C(=O)/C(=C\c3ccc(COc4c(C)cccc4Cl)o3)NC2=S)cn1 |
| InChI | InChI=1S/C22H21ClN4O3S/c1-3-26-11-15(10-24-26)12-27-21(28)19(25-22(27)31)9-16-7-8-17(30-16)13-29-20-14(2)5-4-6-18(20)23/h4-11H,3,12-13H2,1-2H3,(H,25,31)/b19-9+ |
| InChIKey | OGDKMOGEETYSEB-DJKKODMXSA-N |
| XLogP | 4.29 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.96 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|