C27H25Br3N2O5S — CID 19288190
(5E)-3-[2-(3,4-diethoxyphenyl)ethyl]-2-sulfanylidene-5-[[5-[(2,4,6-tribromophenoxy)methyl]furan-2-yl]methylidene]imidazolidin-4-one (PubChem CID 19288190) has the molecular formula C27H25Br3N2O5S and a molecular weight of 729.28 g/mol. Its IUPAC name is (5E)-3-[2-(3,4-diethoxyphenyl)ethyl]-2-sulfanylidene-5-[[5-[(2,4,6-tribromophenoxy)methyl]furan-2-yl]methylidene]imidazolidin-4-one.
| Compound Name | (5E)-3-[2-(3,4-diethoxyphenyl)ethyl]-2-sulfanylidene-5-[[5-[(2,4,6-tribromophenoxy)methyl]furan-2-yl]methylidene]imidazolidin-4-one |
|---|---|
| PubChem CID | 19288190 |
| Molecular Formula | C27H25Br3N2O5S |
| Molecular Weight | 729.28 g/mol |
| Exact Mass | 725.90 |
| IUPAC Name | (5E)-3-[2-(3,4-diethoxyphenyl)ethyl]-2-sulfanylidene-5-[[5-[(2,4,6-tribromophenoxy)methyl]furan-2-yl]methylidene]imidazolidin-4-one |
| SMILES | CCOc1ccc(CCN2C(=O)/C(=C\c3ccc(COc4c(Br)cc(Br)cc4Br)o3)NC2=S)cc1OCC |
| InChI | InChI=1S/C27H25Br3N2O5S/c1-3-34-23-8-5-16(11-24(23)35-4-2)9-10-32-26(33)22(31-27(32)38)14-18-6-7-19(37-18)15-36-25-20(29)12-17(28)13-21(25)30/h5-8,11-14H,3-4,9-10,15H2,1-2H3,(H,31,38)/b22-14+ |
| InChIKey | YDDGLOSGKFGJAV-HYARGMPZSA-N |
| XLogP | 7.24 |
| TPSA | 73.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.28 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|