C24H24BrN3O5S — CID 126087504
(5Z)-5-[[3-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-cyclohexyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126087504) has the molecular formula C24H24BrN3O5S and a molecular weight of 546.44 g/mol. Its IUPAC name is (5Z)-5-[[3-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-cyclohexyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[3-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-cyclohexyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126087504 |
| Molecular Formula | C24H24BrN3O5S |
| Molecular Weight | 546.44 g/mol |
| Exact Mass | 545.06 |
| IUPAC Name | (5Z)-5-[[3-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-cyclohexyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1cc(/C=C2\NC(=S)N(C3CCCCC3)C2=O)cc(Br)c1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H24BrN3O5S/c1-32-21-13-16(12-20-23(29)27(24(34)26-20)17-7-3-2-4-8-17)11-19(25)22(21)33-14-15-6-5-9-18(10-15)28(30)31/h5-6,9-13,17H,2-4,7-8,14H2,1H3,(H,26,34)/b20-12- |
| InChIKey | JVPATCPEMSCILL-NDENLUEZSA-N |
| XLogP | 5.34 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|