C25H27BrN2O3S — CID 126094213
(5Z)-5-[(3-bromo-5-ethoxy-4-phenylmethoxyphenyl)methylidene]-3-cyclohexyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126094213) has the molecular formula C25H27BrN2O3S and a molecular weight of 515.47 g/mol. Its IUPAC name is (5Z)-5-[(3-bromo-5-ethoxy-4-phenylmethoxyphenyl)methylidene]-3-cyclohexyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[(3-bromo-5-ethoxy-4-phenylmethoxyphenyl)methylidene]-3-cyclohexyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126094213 |
| Molecular Formula | C25H27BrN2O3S |
| Molecular Weight | 515.47 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | (5Z)-5-[(3-bromo-5-ethoxy-4-phenylmethoxyphenyl)methylidene]-3-cyclohexyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOc1cc(/C=C2\NC(=S)N(C3CCCCC3)C2=O)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C25H27BrN2O3S/c1-2-30-22-15-18(13-20(26)23(22)31-16-17-9-5-3-6-10-17)14-21-24(29)28(25(32)27-21)19-11-7-4-8-12-19/h3,5-6,9-10,13-15,19H,2,4,7-8,11-12,16H2,1H3,(H,27,32)/b21-14- |
| InChIKey | HZYSDIBGJXSISI-STZFKDTASA-N |
| XLogP | 5.82 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.47 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|