C25H26ClIN2O4 — CID 126083199
(5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-3-cyclohexylimidazolidine-2,4-dione (PubChem CID 126083199) has the molecular formula C25H26ClIN2O4 and a molecular weight of 580.85 g/mol. Its IUPAC name is (5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-3-cyclohexylimidazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-3-cyclohexylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126083199 |
| Molecular Formula | C25H26ClIN2O4 |
| Molecular Weight | 580.85 g/mol |
| Exact Mass | 580.06 |
| IUPAC Name | (5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-3-cyclohexylimidazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2\NC(=O)N(C3CCCCC3)C2=O)cc(I)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H26ClIN2O4/c1-2-32-22-14-17(12-20(27)23(22)33-15-16-8-10-18(26)11-9-16)13-21-24(30)29(25(31)28-21)19-6-4-3-5-7-19/h8-14,19H,2-7,15H2,1H3,(H,28,31)/b21-13- |
| InChIKey | CLYCCCNHPHZFRM-BKUYFWCQSA-N |
| XLogP | 6.15 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.85 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|