C19H15ClI2N2O3 — CID 126237152
(5E)-5-[[4-[(4-chlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-3-ethylimidazolidine-2,4-dione (PubChem CID 126237152) has the molecular formula C19H15ClI2N2O3 and a molecular weight of 608.60 g/mol. Its IUPAC name is (5E)-5-[[4-[(4-chlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-3-ethylimidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-[(4-chlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-3-ethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126237152 |
| Molecular Formula | C19H15ClI2N2O3 |
| Molecular Weight | 608.60 g/mol |
| Exact Mass | 607.89 |
| IUPAC Name | (5E)-5-[[4-[(4-chlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-3-ethylimidazolidine-2,4-dione |
| SMILES | CCN1C(=O)N/C(=C/c2cc(I)c(OCc3ccc(Cl)cc3)c(I)c2)C1=O |
| InChI | InChI=1S/C19H15ClI2N2O3/c1-2-24-18(25)16(23-19(24)26)9-12-7-14(21)17(15(22)8-12)27-10-11-3-5-13(20)6-4-11/h3-9H,2,10H2,1H3,(H,23,26)/b16-9+ |
| InChIKey | HGWBAKKBBQVZOC-CXUHLZMHSA-N |
| XLogP | 5.04 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.60 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|