C22H23IN2O4 — CID 126239095
(5E)-5-[[3-iodo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-propylimidazolidine-2,4-dione (PubChem CID 126239095) has the molecular formula C22H23IN2O4 and a molecular weight of 506.34 g/mol. Its IUPAC name is (5E)-5-[[3-iodo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-propylimidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-iodo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126239095 |
| Molecular Formula | C22H23IN2O4 |
| Molecular Weight | 506.34 g/mol |
| Exact Mass | 506.07 |
| IUPAC Name | (5E)-5-[[3-iodo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-propylimidazolidine-2,4-dione |
| SMILES | CCCN1C(=O)N/C(=C/c2cc(I)c(OCc3ccc(C)cc3)c(OC)c2)C1=O |
| InChI | InChI=1S/C22H23IN2O4/c1-4-9-25-21(26)18(24-22(25)27)11-16-10-17(23)20(19(12-16)28-3)29-13-15-7-5-14(2)6-8-15/h5-8,10-12H,4,9,13H2,1-3H3,(H,24,27)/b18-11+ |
| InChIKey | CFJJEDYCCXJINA-WOJGMQOQSA-N |
| XLogP | 4.49 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.34 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|