C23H18FNO6 — CID 19564817
(E)-3-[3-[(5-fluoro-2-nitrophenoxy)methyl]-4-methoxyphenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one (PubChem CID 19564817) has the molecular formula C23H18FNO6 and a molecular weight of 423.40 g/mol. Its IUPAC name is (E)-3-[3-[(5-fluoro-2-nitrophenoxy)methyl]-4-methoxyphenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-[(5-fluoro-2-nitrophenoxy)methyl]-4-methoxyphenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19564817 |
| Molecular Formula | C23H18FNO6 |
| Molecular Weight | 423.40 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | (E)-3-[3-[(5-fluoro-2-nitrophenoxy)methyl]-4-methoxyphenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(O)cc2)cc1COc1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H18FNO6/c1-30-22-11-3-15(2-10-21(27)16-4-7-19(26)8-5-16)12-17(22)14-31-23-13-18(24)6-9-20(23)25(28)29/h2-13,26H,14H2,1H3/b10-2+ |
| InChIKey | JEDIPGXKKPBREA-WTDSWWLTSA-N |
| XLogP | 4.92 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.40 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|