C20H17FN2O6 — CID 19630930
ethyl (Z)-2-cyano-3-[3-[(5-fluoro-2-nitrophenoxy)methyl]-4-methoxyphenyl]prop-2-enoate (PubChem CID 19630930) has the molecular formula C20H17FN2O6 and a molecular weight of 400.36 g/mol. Its IUPAC name is ethyl (Z)-2-cyano-3-[3-[(5-fluoro-2-nitrophenoxy)methyl]-4-methoxyphenyl]prop-2-enoate.
| Compound Name | ethyl (Z)-2-cyano-3-[3-[(5-fluoro-2-nitrophenoxy)methyl]-4-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 19630930 |
| Molecular Formula | C20H17FN2O6 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | ethyl (Z)-2-cyano-3-[3-[(5-fluoro-2-nitrophenoxy)methyl]-4-methoxyphenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C\c1ccc(OC)c(COc2cc(F)ccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H17FN2O6/c1-3-28-20(24)14(11-22)8-13-4-7-18(27-2)15(9-13)12-29-19-10-16(21)5-6-17(19)23(25)26/h4-10H,3,12H2,1-2H3/b14-8- |
| InChIKey | SFZHPCFJKHJKFT-ZSOIEALJSA-N |
| XLogP | 3.79 |
| TPSA | 111.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|