C25H21Cl3O3 — CID 19562953
(E)-3-[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]-1-(2,4-dichlorophenyl)prop-2-en-1-one (PubChem CID 19562953) has the molecular formula C25H21Cl3O3 and a molecular weight of 475.80 g/mol. Its IUPAC name is (E)-3-[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]-1-(2,4-dichlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]-1-(2,4-dichlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19562953 |
| Molecular Formula | C25H21Cl3O3 |
| Molecular Weight | 475.80 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | (E)-3-[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]-1-(2,4-dichlorophenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(Cl)cc2Cl)cc1COc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C25H21Cl3O3/c1-15-10-20(11-16(2)25(15)28)31-14-18-12-17(5-9-24(18)30-3)4-8-23(29)21-7-6-19(26)13-22(21)27/h4-13H,14H2,1-3H3/b8-4+ |
| InChIKey | VXWUTJHALAAHMX-XBXARRHUSA-N |
| XLogP | 7.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.80 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|