C27H25FN2O6 — CID 75458978
(E)-3-[4-(4-fluorophenoxy)-3-nitrophenyl]-1-[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]prop-2-en-1-one (PubChem CID 75458978) has the molecular formula C27H25FN2O6 and a molecular weight of 492.50 g/mol. Its IUPAC name is (E)-3-[4-(4-fluorophenoxy)-3-nitrophenyl]-1-[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-[4-(4-fluorophenoxy)-3-nitrophenyl]-1-[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 75458978 |
| Molecular Formula | C27H25FN2O6 |
| Molecular Weight | 492.50 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | (E)-3-[4-(4-fluorophenoxy)-3-nitrophenyl]-1-[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2ccc(Oc3ccc(F)cc3)c([N+](=O)[O-])c2)cc1CN1CCOCC1 |
| InChI | InChI=1S/C27H25FN2O6/c1-34-26-11-4-20(17-21(26)18-29-12-14-35-15-13-29)25(31)9-2-19-3-10-27(24(16-19)30(32)33)36-23-7-5-22(28)6-8-23/h2-11,16-17H,12-15,18H2,1H3/b9-2+ |
| InChIKey | HNJQJSYBBMVVMI-XNWCZRBMSA-N |
| XLogP | 5.26 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.50 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|