C26H23NO3S — CID 19556839
(E)-1-(2,5-dimethylthiophen-3-yl)-3-[4-methoxy-3-(quinolin-8-yloxymethyl)phenyl]prop-2-en-1-one (PubChem CID 19556839) has the molecular formula C26H23NO3S and a molecular weight of 429.54 g/mol. Its IUPAC name is (E)-1-(2,5-dimethylthiophen-3-yl)-3-[4-methoxy-3-(quinolin-8-yloxymethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(2,5-dimethylthiophen-3-yl)-3-[4-methoxy-3-(quinolin-8-yloxymethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19556839 |
| Molecular Formula | C26H23NO3S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | (E)-1-(2,5-dimethylthiophen-3-yl)-3-[4-methoxy-3-(quinolin-8-yloxymethyl)phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2cc(C)sc2C)cc1COc1cccc2cccnc12 |
| InChI | InChI=1S/C26H23NO3S/c1-17-14-22(18(2)31-17)23(28)11-9-19-10-12-24(29-3)21(15-19)16-30-25-8-4-6-20-7-5-13-27-26(20)25/h4-15H,16H2,1-3H3/b11-9+ |
| InChIKey | BYJCBJAYPYYBET-PKNBQFBNSA-N |
| XLogP | 6.40 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|