C27H23NO4 — CID 19558622
(E)-1-(4-methoxyphenyl)-3-[4-methoxy-3-(quinolin-8-yloxymethyl)phenyl]prop-2-en-1-one (PubChem CID 19558622) has the molecular formula C27H23NO4 and a molecular weight of 425.48 g/mol. Its IUPAC name is (E)-1-(4-methoxyphenyl)-3-[4-methoxy-3-(quinolin-8-yloxymethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-methoxyphenyl)-3-[4-methoxy-3-(quinolin-8-yloxymethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19558622 |
| Molecular Formula | C27H23NO4 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | (E)-1-(4-methoxyphenyl)-3-[4-methoxy-3-(quinolin-8-yloxymethyl)phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2ccc(OC)c(COc3cccc4cccnc34)c2)cc1 |
| InChI | InChI=1S/C27H23NO4/c1-30-23-12-10-20(11-13-23)24(29)14-8-19-9-15-25(31-2)22(17-19)18-32-26-7-3-5-21-6-4-16-28-27(21)26/h3-17H,18H2,1-2H3/b14-8+ |
| InChIKey | PDBXCOYQBVAXID-RIYZIHGNSA-N |
| XLogP | 5.73 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|