C23H17ClN4O — CID 4139061
N-[(2-chloro-3-phenylprop-2-enylidene)amino]-3-naphthalen-2-yl-1H-pyrazole-5-carboxamide (PubChem CID 4139061) has the molecular formula C23H17ClN4O and a molecular weight of 400.87 g/mol. Its IUPAC name is N-[(2-chloro-3-phenylprop-2-enylidene)amino]-3-naphthalen-2-yl-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(2-chloro-3-phenylprop-2-enylidene)amino]-3-naphthalen-2-yl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 4139061 |
| Molecular Formula | C23H17ClN4O |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | N-[(2-chloro-3-phenylprop-2-enylidene)amino]-3-naphthalen-2-yl-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NN=CC(Cl)=Cc1ccccc1)c1cc(-c2ccc3ccccc3c2)n[nH]1 |
| InChI | InChI=1S/C23H17ClN4O/c24-20(12-16-6-2-1-3-7-16)15-25-28-23(29)22-14-21(26-27-22)19-11-10-17-8-4-5-9-18(17)13-19/h1-15H,(H,26,27)(H,28,29) |
| InChIKey | HRNSQVIZKDTUTD-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|