C22H22N4O — CID 6383435
3-(4-ethylphenyl)-N-[(Z)-[(E)-2-methyl-3-phenylprop-2-enylidene]amino]-1H-pyrazole-5-carboxamide (PubChem CID 6383435) has the molecular formula C22H22N4O and a molecular weight of 358.45 g/mol. Its IUPAC name is 3-(4-ethylphenyl)-N-[(Z)-[(E)-2-methyl-3-phenylprop-2-enylidene]amino]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-ethylphenyl)-N-[(Z)-[(E)-2-methyl-3-phenylprop-2-enylidene]amino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 6383435 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 3-(4-ethylphenyl)-N-[(Z)-[(E)-2-methyl-3-phenylprop-2-enylidene]amino]-1H-pyrazole-5-carboxamide |
| SMILES | CCc1ccc(-c2cc(C(=O)N/N=C\C(C)=C\c3ccccc3)[nH]n2)cc1 |
| InChI | InChI=1S/C22H22N4O/c1-3-17-9-11-19(12-10-17)20-14-21(25-24-20)22(27)26-23-15-16(2)13-18-7-5-4-6-8-18/h4-15H,3H2,1-2H3,(H,24,25)(H,26,27)/b16-13+,23-15- |
| InChIKey | YUVLEDBHCTYIGN-JYMFVFGNSA-N |
| XLogP | 4.46 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|