C26H24N4O — CID 6044027
3-(4-ethylphenyl)-N-[(Z)-1-(4-phenylphenyl)ethylideneamino]-1H-pyrazole-5-carboxamide (PubChem CID 6044027) has the molecular formula C26H24N4O and a molecular weight of 408.51 g/mol. Its IUPAC name is 3-(4-ethylphenyl)-N-[(Z)-1-(4-phenylphenyl)ethylideneamino]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-ethylphenyl)-N-[(Z)-1-(4-phenylphenyl)ethylideneamino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 6044027 |
| Molecular Formula | C26H24N4O |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 3-(4-ethylphenyl)-N-[(Z)-1-(4-phenylphenyl)ethylideneamino]-1H-pyrazole-5-carboxamide |
| SMILES | CCc1ccc(-c2cc(C(=O)N/N=C(/C)c3ccc(-c4ccccc4)cc3)[nH]n2)cc1 |
| InChI | InChI=1S/C26H24N4O/c1-3-19-9-11-23(12-10-19)24-17-25(29-28-24)26(31)30-27-18(2)20-13-15-22(16-14-20)21-7-5-4-6-8-21/h4-17H,3H2,1-2H3,(H,28,29)(H,30,31)/b27-18- |
| InChIKey | LLBPMNXSXHZUQN-IMRQLAEWSA-N |
| XLogP | 5.46 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|